Urolithin B (1139-83-9 factory umzi mveliso

Urolithin B

Novemba 9, 2020

I-Urolithin BSuqobo

igama: Urolithin B
Igama leKhemikhali: I-3-Hydroxy-6H-dibenzo [b, d] ipyran-6-inye
CAS: 1139-83-9
Ifomula Yemichiza: C13H8O3
Isisindo somzimba: 212.2 g / mol
umbala:  Powder
Isitshixo se-InChi: I-WXUQMTRHPNOXBV-UHFFFAOYSA-N
Ikhowudi ye-SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
umsebenzi: I-Urolithin B inokuphucula ukusebenza kwe-mitochondrial kunye nemisipha.

I-Urolithin B inokuphucula amandla emisipha kunye nokunyamezela ngexesha lokuguga.

isicelo: I-Urolithin B yiyimathumbu yentsholongwane yezibalo ze-ellagitannis kwaye ibonisa isenzo esinamandla se-anti-oxidant kunye ne-pro-oxidant kuxhomekeka kwinkqubo kunye neemeko. I-Urolithin B inokubonakalisa kwakhona i-estrogenic kunye / okanye imisebenzi echasene ne-estrogenic.
Umzimba: Kunyibilika ngokulula i-N, N-dimethylformamide kunye ne-dimethylmethylene. I-Sulfone, inyibilika kancinci kwi-methanol, i-ethanol, kunye ne-ethyl acetate
Isitoreji sokugcina: I-Hygroscopic, -20 ° C I-Freezer, Ngaphakathi kwemoya engenayo
Umbandela wokuhambisa: Ukuthunyelwa phantsi kobushushu obumgangatho obuninzi njengemichiza engabungozi. Lo mveliso uzinzile ngokwaneleyo kwiiveki ezimbalwa ngexesha lokuthumela ngokuqhelekileyo kunye nexesha elichithwe kwiDavi.